C28H25N3O3 — CID 4942074
N-(4-anilinophenyl)-2-(2-phenoxypropanoylamino)benzamide (PubChem CID 4942074) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-(2-phenoxypropanoylamino)benzamide.
| Compound Name | N-(4-anilinophenyl)-2-(2-phenoxypropanoylamino)benzamide |
|---|---|
| PubChem CID | 4942074 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-(4-anilinophenyl)-2-(2-phenoxypropanoylamino)benzamide |
| SMILES | CC(Oc1ccccc1)C(=O)Nc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3O3/c1-20(34-24-12-6-3-7-13-24)27(32)31-26-15-9-8-14-25(26)28(33)30-23-18-16-22(17-19-23)29-21-10-4-2-5-11-21/h2-20,29H,1H3,(H,30,33)(H,31,32) |
| InChIKey | RYAPXFVSVPQLPW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |