C30H29N3O3 — CID 4944912
N-(4-anilinophenyl)-2-[2-(2,5-dimethylphenoxy)propanoylamino]benzamide (PubChem CID 4944912) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[2-(2,5-dimethylphenoxy)propanoylamino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[2-(2,5-dimethylphenoxy)propanoylamino]benzamide |
|---|---|
| PubChem CID | 4944912 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-(4-anilinophenyl)-2-[2-(2,5-dimethylphenoxy)propanoylamino]benzamide |
| SMILES | Cc1ccc(C)c(OC(C)C(=O)Nc2ccccc2C(=O)Nc2ccc(Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H29N3O3/c1-20-13-14-21(2)28(19-20)36-22(3)29(34)33-27-12-8-7-11-26(27)30(35)32-25-17-15-24(16-18-25)31-23-9-5-4-6-10-23/h4-19,22,31H,1-3H3,(H,32,35)(H,33,34) |
| InChIKey | UQHQGLAKGOKCJP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |