C23H23NO2 — CID 40866622
(2S)-2-(2,5-dimethylphenoxy)-N-(2-phenylphenyl)propanamide (PubChem CID 40866622) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethylphenoxy)-N-(2-phenylphenyl)propanamide.
| Compound Name | (2S)-2-(2,5-dimethylphenoxy)-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 40866622 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S)-2-(2,5-dimethylphenoxy)-N-(2-phenylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(O[C@@H](C)C(=O)Nc2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H23NO2/c1-16-13-14-17(2)22(15-16)26-18(3)23(25)24-21-12-8-7-11-20(21)19-9-5-4-6-10-19/h4-15,18H,1-3H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | JPKKVEXRBSZLOE-SFHVURJKSA-N |
| XLogP | 5.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |