C28H24N2O3 — CID 41131403
2-[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl]oxy-N-phenylbenzamide (PubChem CID 41131403) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl]oxy-N-phenylbenzamide.
| Compound Name | 2-[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl]oxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 41131403 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl]oxy-N-phenylbenzamide |
| SMILES | C[C@H](Oc1ccccc1C(=O)Nc1ccccc1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C28H24N2O3/c1-20(27(31)30-25-18-10-8-16-23(25)21-12-4-2-5-13-21)33-26-19-11-9-17-24(26)28(32)29-22-14-6-3-7-15-22/h2-20H,1H3,(H,29,32)(H,30,31)/t20-/m0/s1 |
| InChIKey | NOXTTYUUUAYSDK-FQEVSTJZSA-N |
| XLogP | 6.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |