C10H22N4O2 — CID 119497921
(2R)-N-(3-aminobutyl)-2-(carbamoylamino)pentanamide (PubChem CID 119497921) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2R)-N-(3-aminobutyl)-2-(carbamoylamino)pentanamide.
| Compound Name | (2R)-N-(3-aminobutyl)-2-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 119497921 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (2R)-N-(3-aminobutyl)-2-(carbamoylamino)pentanamide |
| SMILES | CCC[C@@H](NC(N)=O)C(=O)NCCC(C)N |
| InChI | InChI=1S/C10H22N4O2/c1-3-4-8(14-10(12)16)9(15)13-6-5-7(2)11/h7-8H,3-6,11H2,1-2H3,(H,13,15)(H3,12,14,16)/t7?,8-/m1/s1 |
| InChIKey | JKUFIGCLTGFONN-BRFYHDHCSA-N |
| XLogP | -0.32 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |