C10H20N4O3 — CID 94200506
(2R)-2-(carbamoylamino)-N-[2-(dimethylamino)-2-oxoethyl]pentanamide (PubChem CID 94200506) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-N-[2-(dimethylamino)-2-oxoethyl]pentanamide.
| Compound Name | (2R)-2-(carbamoylamino)-N-[2-(dimethylamino)-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 94200506 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2R)-2-(carbamoylamino)-N-[2-(dimethylamino)-2-oxoethyl]pentanamide |
| SMILES | CCC[C@@H](NC(N)=O)C(=O)NCC(=O)N(C)C |
| InChI | InChI=1S/C10H20N4O3/c1-4-5-7(13-10(11)17)9(16)12-6-8(15)14(2)3/h7H,4-6H2,1-3H3,(H,12,16)(H3,11,13,17)/t7-/m1/s1 |
| InChIKey | ZSZGXBLTPMKNDY-SSDOTTSWSA-N |
| XLogP | -0.97 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |