C11H22N4O2 — CID 119552995
(2R)-2-(carbamoylamino)-N-methyl-N-pyrrolidin-3-ylpentanamide (PubChem CID 119552995) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-N-methyl-N-pyrrolidin-3-ylpentanamide.
| Compound Name | (2R)-2-(carbamoylamino)-N-methyl-N-pyrrolidin-3-ylpentanamide |
|---|---|
| PubChem CID | 119552995 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2R)-2-(carbamoylamino)-N-methyl-N-pyrrolidin-3-ylpentanamide |
| SMILES | CCC[C@@H](NC(N)=O)C(=O)N(C)C1CCNC1 |
| InChI | InChI=1S/C11H22N4O2/c1-3-4-9(14-11(12)17)10(16)15(2)8-5-6-13-7-8/h8-9,13H,3-7H2,1-2H3,(H3,12,14,17)/t8?,9-/m1/s1 |
| InChIKey | IXKZTAWACJQIPJ-YGPZHTELSA-N |
| XLogP | -0.36 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |