C12H24N2O — CID 60806895
N,2-dimethyl-N-piperidin-3-ylpentanamide (PubChem CID 60806895) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N,2-dimethyl-N-piperidin-3-ylpentanamide.
| Compound Name | N,2-dimethyl-N-piperidin-3-ylpentanamide |
|---|---|
| PubChem CID | 60806895 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N,2-dimethyl-N-piperidin-3-ylpentanamide |
| SMILES | CCCC(C)C(=O)N(C)C1CCCNC1 |
| InChI | InChI=1S/C12H24N2O/c1-4-6-10(2)12(15)14(3)11-7-5-8-13-9-11/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | UGWSOZZEKNKTTF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |