C9H20N2O — CID 28569844
N,N-dimethyl-2-[[(2R)-pentan-2-yl]amino]acetamide (PubChem CID 28569844) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2R)-pentan-2-yl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2R)-pentan-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 28569844 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N,N-dimethyl-2-[[(2R)-pentan-2-yl]amino]acetamide |
| SMILES | CCC[C@@H](C)NCC(=O)N(C)C |
| InChI | InChI=1S/C9H20N2O/c1-5-6-8(2)10-7-9(12)11(3)4/h8,10H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | TXVCGKSRLNLBLN-MRVPVSSYSA-N |
| XLogP | 0.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |