C8H18N2O — CID 28565761
2-[[(2S)-butan-2-yl]amino]-N,N-dimethylacetamide (PubChem CID 28565761) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is 2-[[(2S)-butan-2-yl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(2S)-butan-2-yl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 28565761 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-[[(2S)-butan-2-yl]amino]-N,N-dimethylacetamide |
| SMILES | CC[C@H](C)NCC(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O/c1-5-7(2)9-6-8(11)10(3)4/h7,9H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | UGAVYSXDHMRKQB-ZETCQYMHSA-N |
| XLogP | 0.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |