C10H22N2O — CID 43310901
N,N-dimethyl-2-(4-methylpentan-2-ylamino)acetamide (PubChem CID 43310901) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-methylpentan-2-ylamino)acetamide.
| Compound Name | N,N-dimethyl-2-(4-methylpentan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 43310901 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N,N-dimethyl-2-(4-methylpentan-2-ylamino)acetamide |
| SMILES | CC(C)CC(C)NCC(=O)N(C)C |
| InChI | InChI=1S/C10H22N2O/c1-8(2)6-9(3)11-7-10(13)12(4)5/h8-9,11H,6-7H2,1-5H3 |
| InChIKey | WWDWCXDFMPBUSC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |