C4H12AlN4O6 — CID 174427848
CID 174427848 (PubChem CID 174427848) has the molecular formula C4H12AlN4O6 and a molecular weight of 239.14 g/mol.
| Compound Name | CID 174427848 |
|---|---|
| PubChem CID | 174427848 |
| Molecular Formula | C4H12AlN4O6 |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | — |
| SMILES | NC(=O)NC(NC(N)=O)C(=O)O.O.O.[Al] |
| InChI | InChI=1S/C4H8N4O4.Al.2H2O/c5-3(11)7-1(2(9)10)8-4(6)12;;;/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12);;2*1H2 |
| InChIKey | JIBUYQRGSCWVDY-UHFFFAOYSA-N |
| XLogP | -4.30 |
| TPSA | 210.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|