About 1-cyanoethylurea
1-cyanoethylurea (PubChem CID 61124202) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 1-cyanoethylurea.
Molecular Properties
| Compound Name | 1-cyanoethylurea |
| PubChem CID | 61124202 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 1-cyanoethylurea |
| SMILES | CC(C#N)NC(N)=O |
| InChI | InChI=1S/C4H7N3O/c1-3(2-5)7-4(6)8/h3H,1H3,(H3,6,7,8) |
| InChIKey | YLYPNSSIEICLKZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyanoethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethylurea?
The IUPAC name of 1-cyanoethylurea (CID 61124202) is 1-cyanoethylurea.
What is the SMILES notation for 1-cyanoethylurea?
The canonical SMILES for 1-cyanoethylurea is CC(C#N)NC(N)=O.
What is the InChIKey of 1-cyanoethylurea?
The InChIKey is YLYPNSSIEICLKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c1-3(2-5)7-4(6)8/h3H,1H3,(H3,6,7,8).
What are the key properties of 1-cyanoethylurea?
1-cyanoethylurea has a molecular weight of 113.12 g/mol, XLogP of -0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethylurea is sourced from PubChem (CID 61124202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).