C8H12F2N2O — CID 130677855
N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide (PubChem CID 130677855) has the molecular formula C8H12F2N2O and a molecular weight of 190.19 g/mol. Its IUPAC name is N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide.
| Compound Name | N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 130677855 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide |
| SMILES | C[C@H](C#N)NC(=O)C(C)(C)C(F)F |
| InChI | InChI=1S/C8H12F2N2O/c1-5(4-11)12-7(13)8(2,3)6(9)10/h5-6H,1-3H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | MBGAARSTEXRTQB-RXMQYKEDSA-N |
| XLogP | 1.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |