About N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide
N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide (PubChem CID 130677855) has the molecular formula C8H12F2N2O
and a molecular weight of 190.19 g/mol. Its IUPAC name is N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide |
| PubChem CID | 130677855 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide |
| SMILES | C[C@H](C#N)NC(=O)C(C)(C)C(F)F |
| InChI | InChI=1S/C8H12F2N2O/c1-5(4-11)12-7(13)8(2,3)6(9)10/h5-6H,1-3H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | MBGAARSTEXRTQB-RXMQYKEDSA-N |
| XLogP | 1.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide?
The IUPAC name of N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide (CID 130677855) is N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide?
The canonical SMILES for N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide is C[C@H](C#N)NC(=O)C(C)(C)C(F)F.
What is the InChIKey of N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide?
The InChIKey is MBGAARSTEXRTQB-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H12F2N2O/c1-5(4-11)12-7(13)8(2,3)6(9)10/h5-6H,1-3H3,(H,12,13)/t5-/m1/s1.
What are the key properties of N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide?
N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide has a molecular weight of 190.19 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-cyanoethyl]-3,3-difluoro-2,2-dimethylpropanamide is sourced from PubChem (CID 130677855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).