C9H14N2O2 — CID 131085841
N-(1-cyanoethyl)-3,3-dimethyl-2-oxobutanamide (PubChem CID 131085841) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is N-(1-cyanoethyl)-3,3-dimethyl-2-oxobutanamide.
| Compound Name | N-(1-cyanoethyl)-3,3-dimethyl-2-oxobutanamide |
|---|---|
| PubChem CID | 131085841 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N-(1-cyanoethyl)-3,3-dimethyl-2-oxobutanamide |
| SMILES | CC(C#N)NC(=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C9H14N2O2/c1-6(5-10)11-8(13)7(12)9(2,3)4/h6H,1-4H3,(H,11,13) |
| InChIKey | BGLAPFIHMIOTNX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|