C4H9ClN2 — CID 163739857
1-N'-(1-chloroethyl)ethene-1,1-diamine (PubChem CID 163739857) has the molecular formula C4H9ClN2 and a molecular weight of 120.58 g/mol. Its IUPAC name is 1-N'-(1-chloroethyl)ethene-1,1-diamine.
| Compound Name | 1-N'-(1-chloroethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 163739857 |
| Molecular Formula | C4H9ClN2 |
| Molecular Weight | 120.58 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | 1-N'-(1-chloroethyl)ethene-1,1-diamine |
| SMILES | C=C(N)NC(C)Cl |
| InChI | InChI=1S/C4H9ClN2/c1-3(5)7-4(2)6/h3,7H,2,6H2,1H3 |
| InChIKey | LGVDMPSVMZKXDD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.58 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|