C12H26O6Si — CID 67147218
(2S,3R,4S,5R,6R)-3-[butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 67147218) has the molecular formula C12H26O6Si and a molecular weight of 294.42 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3-[butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-3-[butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 67147218 |
| Molecular Formula | C12H26O6Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3-[butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCCC[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C12H26O6Si/c1-4-5-6-19(2,3)18-11-10(15)9(14)8(7-13)17-12(11)16/h8-16H,4-7H2,1-3H3/t8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | GPICEHVJXOWTSQ-IIRVCBMXSA-N |
| XLogP | -0.19 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|