C22H34F3NO5Si — CID 138980835
[(2S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 138980835) has the molecular formula C22H34F3NO5Si and a molecular weight of 477.60 g/mol. Its IUPAC name is [(2S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(2S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 138980835 |
| Molecular Formula | C22H34F3NO5Si |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | [(2S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | COC1C(O[Si](C)(C)C(C)(C)C)[C@H](OC)C(C)O[C@H]1O/C(=N/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H34F3NO5Si/c1-14-16(27-5)17(31-32(7,8)21(2,3)4)18(28-6)19(29-14)30-20(22(23,24)25)26-15-12-10-9-11-13-15/h9-14,16-19H,1-8H3/b26-20+/t14?,16-,17?,18?,19+/m1/s1 |
| InChIKey | LNRLBOFKKNWSCV-OTCFYTLMSA-N |
| XLogP | 5.46 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|