C18H19F3INO6 — CID 134844829
[(3R,6S)-4-acetyloxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate (PubChem CID 134844829) has the molecular formula C18H19F3INO6 and a molecular weight of 529.25 g/mol. Its IUPAC name is [(3R,6S)-4-acetyloxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate.
| Compound Name | [(3R,6S)-4-acetyloxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 134844829 |
| Molecular Formula | C18H19F3INO6 |
| Molecular Weight | 529.25 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | [(3R,6S)-4-acetyloxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(I)[C@H](O/C(=N/c2ccccc2)C(F)(F)F)OC(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19F3INO6/c1-9-14(27-10(2)24)15(28-11(3)25)13(22)16(26-9)29-17(18(19,20)21)23-12-7-5-4-6-8-12/h4-9,13-16H,1-3H3/b23-17+/t9?,13?,14-,15?,16+/m1/s1 |
| InChIKey | SWVDFXZRFARENS-IRZVEZLYSA-N |
| XLogP | 3.71 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|