C34H40F3NO18 — CID 135023255
[(4S)-3,4,5-triacetyloxy-6-[[(4S)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 135023255) has the molecular formula C34H40F3NO18 and a molecular weight of 807.68 g/mol. Its IUPAC name is [(4S)-3,4,5-triacetyloxy-6-[[(4S)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(4S)-3,4,5-triacetyloxy-6-[[(4S)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135023255 |
| Molecular Formula | C34H40F3NO18 |
| Molecular Weight | 807.68 g/mol |
| Exact Mass | 807.22 |
| IUPAC Name | [(4S)-3,4,5-triacetyloxy-6-[[(4S)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCC2OC(O/C(=N/c3ccccc3)C(F)(F)F)C(OC(C)=O)[C@@H](OC(C)=O)C2OC(C)=O)C(OC(C)=O)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C34H40F3NO18/c1-15(39)46-13-23-25(48-16(2)40)27(50-18(4)42)29(52-20(6)44)31(54-23)47-14-24-26(49-17(3)41)28(51-19(5)43)30(53-21(7)45)32(55-24)56-33(34(35,36)37)38-22-11-9-8-10-12-22/h8-12,23-32H,13-14H2,1-7H3/b38-33+/t23?,24?,25?,26?,27-,28-,29?,30?,31?,32?/m0/s1 |
| InChIKey | VIVGKIKCFQIZTM-DJMFPRSQSA-N |
| XLogP | 1.92 |
| TPSA | 233.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|