C32H38F3NO5Si — CID 166445602
[(2S,3R,4S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 166445602) has the molecular formula C32H38F3NO5Si and a molecular weight of 601.74 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(2S,3R,4S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 166445602 |
| Molecular Formula | C32H38F3NO5Si |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-5-[tert-butyl(diphenyl)silyl]oxy-3,4-dimethoxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | CO[C@@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)O[C@@H](O/C(=N/c2ccccc2)C(F)(F)F)[C@@H]1OC |
| InChI | InChI=1S/C32H38F3NO5Si/c1-22-26(41-42(31(2,3)4,24-18-12-8-13-19-24)25-20-14-9-15-21-25)27(37-5)28(38-6)29(39-22)40-30(32(33,34)35)36-23-16-10-7-11-17-23/h7-22,26-29H,1-6H3/b36-30+/t22-,26-,27+,28+,29-/m0/s1 |
| InChIKey | FUMGBVQJRKSWLR-COCSLXGWSA-N |
| XLogP | 6.02 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|