C34H60F3NO6Si3 — CID 56647004
[(4aR,7R,8S,8aS)-2,2-ditert-butyl-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 56647004) has the molecular formula C34H60F3NO6Si3 and a molecular weight of 720.11 g/mol. Its IUPAC name is [(4aR,7R,8S,8aS)-2,2-ditert-butyl-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(4aR,7R,8S,8aS)-2,2-ditert-butyl-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 56647004 |
| Molecular Formula | C34H60F3NO6Si3 |
| Molecular Weight | 720.11 g/mol |
| Exact Mass | 719.37 |
| IUPAC Name | [(4aR,7R,8S,8aS)-2,2-ditert-butyl-7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H]2O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]2OC(O/C(=N/c2ccccc2)C(F)(F)F)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H60F3NO6Si3/c1-30(2,3)45(13,14)42-26-25-24(22-39-47(44-25,32(7,8)9)33(10,11)12)40-28(27(26)43-46(15,16)31(4,5)6)41-29(34(35,36)37)38-23-20-18-17-19-21-23/h17-21,24-28H,22H2,1-16H3/b38-29+/t24-,25+,26+,27-,28?/m1/s1 |
| InChIKey | RVFZGHSGFHPAOX-WLDVVGAWSA-N |
| XLogP | 10.26 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.11 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|