C26H36F3NO9Si — CID 11767117
[(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate (PubChem CID 11767117) has the molecular formula C26H36F3NO9Si and a molecular weight of 591.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11767117 |
| Molecular Formula | C26H36F3NO9Si |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(O/C(=N/c2ccccc2)C(F)(F)F)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H36F3NO9Si/c1-15(31)35-20-19(14-34-40(7,8)25(4,5)6)38-23(22(37-17(3)33)21(20)36-16(2)32)39-24(26(27,28)29)30-18-12-10-9-11-13-18/h9-13,19-23H,14H2,1-8H3/b30-24+/t19-,20-,21+,22-,23?/m1/s1 |
| InChIKey | FWZSXDRQOUPKDI-OAQDMNBMSA-N |
| XLogP | 4.84 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|