C22H24F3NO10 — CID 101398062
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate (PubChem CID 101398062) has the molecular formula C22H24F3NO10 and a molecular weight of 519.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101398062 |
| Molecular Formula | C22H24F3NO10 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O/C(=N/c2ccccc2)C(F)(F)F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H24F3NO10/c1-11(27)31-10-16-17(32-12(2)28)18(33-13(3)29)19(34-14(4)30)20(35-16)36-21(22(23,24)25)26-15-8-6-5-7-9-15/h5-9,16-20H,10H2,1-4H3/b26-21+/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | WIIDDTVXOWMTFB-MHANXUPQSA-N |
| XLogP | 2.38 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|