C22H24F3NO9S — CID 135078393
[3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 135078393) has the molecular formula C22H24F3NO9S and a molecular weight of 535.49 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135078393 |
| Molecular Formula | C22H24F3NO9S |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(S/C(=N/c2ccccc2)C(F)(F)F)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H24F3NO9S/c1-11(27)31-10-16-17(32-12(2)28)18(33-13(3)29)19(34-14(4)30)20(35-16)36-21(22(23,24)25)26-15-8-6-5-7-9-15/h5-9,16-20H,10H2,1-4H3/b26-21+ |
| InChIKey | QOTUKDXOJMFIJV-YYADALCUSA-N |
| XLogP | 3.10 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|