C20H22F3NO8 — CID 10874217
[(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate (PubChem CID 10874217) has the molecular formula C20H22F3NO8 and a molecular weight of 461.39 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 10874217 |
| Molecular Formula | C20H22F3NO8 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](C)O[C@H](O/C(=N/c2ccccc2)C(F)(F)F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H22F3NO8/c1-10-15(29-11(2)25)16(30-12(3)26)17(31-13(4)27)18(28-10)32-19(20(21,22)23)24-14-8-6-5-7-9-14/h5-10,15-18H,1-4H3/b24-19+/t10-,15-,16+,17+,18+/m0/s1 |
| InChIKey | DSNYPEWWBKDGKS-NZXZKSOISA-N |
| XLogP | 2.84 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|