C22H31F3INO5Si — CID 54756540
[(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate (PubChem CID 54756540) has the molecular formula C22H31F3INO5Si and a molecular weight of 601.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 54756540 |
| Molecular Formula | C22H31F3INO5Si |
| Molecular Weight | 601.48 g/mol |
| Exact Mass | 601.10 |
| IUPAC Name | [(2R,3R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-iodo-2-methyl-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](I)C(O/C(=N/c2ccccc2)C(F)(F)F)O[C@@H]1C |
| InChI | InChI=1S/C22H31F3INO5Si/c1-13-17(30-14(2)28)18(32-33(6,7)21(3,4)5)16(26)19(29-13)31-20(22(23,24)25)27-15-11-9-8-10-12-15/h8-13,16-19H,1-7H3/b27-20+/t13-,16-,17-,18-,19?/m1/s1 |
| InChIKey | MECDERQEYJYDDG-RVIGODNCSA-N |
| XLogP | 6.17 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|