C23H42Br2O7Si — CID 11192858
(2E,5S,6R)-8,8-dibromo-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyocta-2,7-dien-1-ol (PubChem CID 11192858) has the molecular formula C23H42Br2O7Si and a molecular weight of 618.48 g/mol. Its IUPAC name is (2E,5S,6R)-8,8-dibromo-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyocta-2,7-dien-1-ol.
| Compound Name | (2E,5S,6R)-8,8-dibromo-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyocta-2,7-dien-1-ol |
|---|---|
| PubChem CID | 11192858 |
| Molecular Formula | C23H42Br2O7Si |
| Molecular Weight | 618.48 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | (2E,5S,6R)-8,8-dibromo-6-[tert-butyl(dimethyl)silyl]oxy-5-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxyocta-2,7-dien-1-ol |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O[C@@H](C/C=C/CO)[C@@H](C=C(Br)Br)O[Si](C)(C)C(C)(C)C)[C@@H]1OC |
| InChI | InChI=1S/C23H42Br2O7Si/c1-15-19(27-5)20(28-6)21(29-7)22(30-15)31-16(12-10-11-13-26)17(14-18(24)25)32-33(8,9)23(2,3)4/h10-11,14-17,19-22,26H,12-13H2,1-9H3/b11-10+/t15-,16-,17+,19-,20+,21+,22-/m0/s1 |
| InChIKey | DHBYNNMJGZUKGB-OZDFIYDBSA-N |
| XLogP | 5.12 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|