C23H48O5Si2 — CID 10863498
(E)-4-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-2-en-1-ol (PubChem CID 10863498) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is (E)-4-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-2-en-1-ol.
| Compound Name | (E)-4-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 10863498 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (E)-4-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-2-en-1-ol |
| SMILES | CO[C@@H]1O[C@@H](C/C=C/CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O5Si2/c1-17-19(27-29(9,10)22(2,3)4)18(15-13-14-16-24)26-21(25-8)20(17)28-30(11,12)23(5,6)7/h13-14,17-21,24H,15-16H2,1-12H3/b14-13+/t17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | BUGZPQRDFZVVLR-HYOMVRIFSA-N |
| XLogP | 5.71 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|