C40H49IO5Si2 — CID 101050608
[(2S,3R,4S,5R,6S)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-yl] acetate (PubChem CID 101050608) has the molecular formula C40H49IO5Si2 and a molecular weight of 792.90 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-yl] acetate |
|---|---|
| PubChem CID | 101050608 |
| Molecular Formula | C40H49IO5Si2 |
| Molecular Weight | 792.90 g/mol |
| Exact Mass | 792.22 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-4,5-bis[[tert-butyl(diphenyl)silyl]oxy]-3-iodo-6-methyloxan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@@H](C)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1I |
| InChI | InChI=1S/C40H49IO5Si2/c1-29-36(45-47(39(3,4)5,31-21-13-9-14-22-31)32-23-15-10-16-24-32)37(35(41)38(43-29)44-30(2)42)46-48(40(6,7)8,33-25-17-11-18-26-33)34-27-19-12-20-28-34/h9-29,35-38H,1-8H3/t29-,35+,36+,37+,38-/m0/s1 |
| InChIKey | JIRLJHNIOPYORX-OYZANDQKSA-N |
| XLogP | 6.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.90 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|