C20H31NO5Si — CID 100997154
[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate (PubChem CID 100997154) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate.
| Compound Name | [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate |
|---|---|
| PubChem CID | 100997154 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate |
| SMILES | COC(=O)C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H31NO5Si/c1-20(2,3)27(5,6)26-17-12-16(13-18(22)24-4)21(14-17)25-19(23)15-10-8-7-9-11-15/h7-11,16-17H,12-14H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | CJTUFDWFNUMHNX-IAGOWNOFSA-N |
| XLogP | 3.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|