About [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate
[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate (PubChem CID 100997154) has the molecular formula C20H31NO5Si
and a molecular weight of 393.56 g/mol. Its IUPAC name is [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate.
Molecular Properties
| Compound Name | [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate |
| PubChem CID | 100997154 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate |
| SMILES | COC(=O)C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H31NO5Si/c1-20(2,3)27(5,6)26-17-12-16(13-18(22)24-4)21(14-17)25-19(23)15-10-8-7-9-11-15/h7-11,16-17H,12-14H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | CJTUFDWFNUMHNX-IAGOWNOFSA-N |
| XLogP | 3.79 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate?
The IUPAC name of [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate (CID 100997154) is [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate.
What is the SMILES notation for [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate?
The canonical SMILES for [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate is COC(=O)C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1OC(=O)c1ccccc1.
What is the InChIKey of [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate?
The InChIKey is CJTUFDWFNUMHNX-IAGOWNOFSA-N. The full InChI is InChI=1S/C20H31NO5Si/c1-20(2,3)27(5,6)26-17-12-16(13-18(22)24-4)21(14-17)25-19(23)15-10-8-7-9-11-15/h7-11,16-17H,12-14H2,1-6H3/t16-,17-/m1/s1.
What are the key properties of [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate?
[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate has a molecular weight of 393.56 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-methoxy-2-oxoethyl)pyrrolidin-1-yl] benzoate is sourced from PubChem (CID 100997154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).