C13H13BrO3 — CID 10085967
[(2S,3S)-2-ethenyloxolan-3-yl] 4-bromobenzoate (PubChem CID 10085967) has the molecular formula C13H13BrO3 and a molecular weight of 297.15 g/mol. Its IUPAC name is [(2S,3S)-2-ethenyloxolan-3-yl] 4-bromobenzoate.
| Compound Name | [(2S,3S)-2-ethenyloxolan-3-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 10085967 |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | [(2S,3S)-2-ethenyloxolan-3-yl] 4-bromobenzoate |
| SMILES | C=C[C@@H]1OCC[C@@H]1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13BrO3/c1-2-11-12(7-8-16-11)17-13(15)9-3-5-10(14)6-4-9/h2-6,11-12H,1,7-8H2/t11-,12-/m0/s1 |
| InChIKey | MESFZNVRMGXTGA-RYUDHWBXSA-N |
| XLogP | 2.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|