C20H19BrO2 — CID 139057155
[(1S,2R,3S,6R,7S,8R)-12-methylidene-11-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-bromobenzoate (PubChem CID 139057155) has the molecular formula C20H19BrO2 and a molecular weight of 371.27 g/mol. Its IUPAC name is [(1S,2R,3S,6R,7S,8R)-12-methylidene-11-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-bromobenzoate.
| Compound Name | [(1S,2R,3S,6R,7S,8R)-12-methylidene-11-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 139057155 |
| Molecular Formula | C20H19BrO2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [(1S,2R,3S,6R,7S,8R)-12-methylidene-11-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl] 4-bromobenzoate |
| SMILES | C=C1[C@H]2CC[C@@H]1[C@@H]1[C@H]2[C@@H]2C=C[C@H]1C2OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H19BrO2/c1-10-13-6-7-14(10)18-16-9-8-15(17(13)18)19(16)23-20(22)11-2-4-12(21)5-3-11/h2-5,8-9,13-19H,1,6-7H2/t13-,14+,15+,16-,17-,18+,19? |
| InChIKey | HBEQLGPMWIHICA-CLEHKZJXSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|