C17H15BrO2 — CID 5251664
3-tricyclo[5.2.1.02,6]deca-4,8-dienyl 4-bromobenzoate (PubChem CID 5251664) has the molecular formula C17H15BrO2 and a molecular weight of 331.21 g/mol. Its IUPAC name is 3-tricyclo[5.2.1.02,6]deca-4,8-dienyl 4-bromobenzoate.
| Compound Name | 3-tricyclo[5.2.1.02,6]deca-4,8-dienyl 4-bromobenzoate |
|---|---|
| PubChem CID | 5251664 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-tricyclo[5.2.1.02,6]deca-4,8-dienyl 4-bromobenzoate |
| SMILES | O=C(OC1C=CC2C3C=CC(C3)C12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrO2/c18-13-5-3-10(4-6-13)17(19)20-15-8-7-14-11-1-2-12(9-11)16(14)15/h1-8,11-12,14-16H,9H2 |
| InChIKey | TVLQTCOLSIZGDV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|