C12H16O2 — CID 130128012
2-(3-tricyclo[5.2.1.02,6]deca-4,8-dienyloxy)ethanol (PubChem CID 130128012) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(3-tricyclo[5.2.1.02,6]deca-4,8-dienyloxy)ethanol.
| Compound Name | 2-(3-tricyclo[5.2.1.02,6]deca-4,8-dienyloxy)ethanol |
|---|---|
| PubChem CID | 130128012 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-(3-tricyclo[5.2.1.02,6]deca-4,8-dienyloxy)ethanol |
| SMILES | OCCOC1C=CC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C12H16O2/c13-5-6-14-11-4-3-10-8-1-2-9(7-8)12(10)11/h1-4,8-13H,5-7H2 |
| InChIKey | MPEPZEXQCNNPDX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|