C17H14BrNO4 — CID 117070620
[(2R,3S,6S)-4-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] 4-nitrobenzoate (PubChem CID 117070620) has the molecular formula C17H14BrNO4 and a molecular weight of 376.21 g/mol. Its IUPAC name is [(2R,3S,6S)-4-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] 4-nitrobenzoate.
| Compound Name | [(2R,3S,6S)-4-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 117070620 |
| Molecular Formula | C17H14BrNO4 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | [(2R,3S,6S)-4-bromo-3-tricyclo[5.2.1.02,6]deca-4,8-dienyl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1C(Br)=C[C@H]2C3C=CC(C3)[C@@H]12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14BrNO4/c18-14-8-13-10-1-2-11(7-10)15(13)16(14)23-17(20)9-3-5-12(6-4-9)19(21)22/h1-6,8,10-11,13,15-16H,7H2/t10?,11?,13-,15+,16+/m0/s1 |
| InChIKey | OCBPPFZOKAKNTC-MRCWIDPDSA-N |
| XLogP | 3.85 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|