C16H19BrO3 — CID 10020062
[(1R,2S,5R,9S)-9-hydroxy-2-bicyclo[3.3.1]nonanyl] 4-bromobenzoate (PubChem CID 10020062) has the molecular formula C16H19BrO3 and a molecular weight of 339.23 g/mol. Its IUPAC name is [(1R,2S,5R,9S)-9-hydroxy-2-bicyclo[3.3.1]nonanyl] 4-bromobenzoate.
| Compound Name | [(1R,2S,5R,9S)-9-hydroxy-2-bicyclo[3.3.1]nonanyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 10020062 |
| Molecular Formula | C16H19BrO3 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [(1R,2S,5R,9S)-9-hydroxy-2-bicyclo[3.3.1]nonanyl] 4-bromobenzoate |
| SMILES | O=C(O[C@H]1CC[C@H]2CCC[C@@H]1[C@H]2O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H19BrO3/c17-12-7-4-11(5-8-12)16(19)20-14-9-6-10-2-1-3-13(14)15(10)18/h4-5,7-8,10,13-15,18H,1-3,6,9H2/t10-,13+,14+,15+/m1/s1 |
| InChIKey | JDCZRZNAFHMMET-KJEVXHAQSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |