C15H15BrO4 — CID 10759498
[(3aR,6S,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-6-yl] 4-bromobenzoate (PubChem CID 10759498) has the molecular formula C15H15BrO4 and a molecular weight of 339.19 g/mol. Its IUPAC name is [(3aR,6S,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-6-yl] 4-bromobenzoate.
| Compound Name | [(3aR,6S,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-6-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 10759498 |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [(3aR,6S,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-6-yl] 4-bromobenzoate |
| SMILES | O=C1C[C@H]2CC[C@H](OC(=O)c3ccc(Br)cc3)C[C@H]2O1 |
| InChI | InChI=1S/C15H15BrO4/c16-11-4-1-9(2-5-11)15(18)19-12-6-3-10-7-14(17)20-13(10)8-12/h1-2,4-5,10,12-13H,3,6-8H2/t10-,12+,13-/m1/s1 |
| InChIKey | PNJYDXCYRYZBHW-KGYLQXTDSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |