C24H23BrO5 — CID 78237804
[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-bromobenzoate (PubChem CID 78237804) has the molecular formula C24H23BrO5 and a molecular weight of 471.35 g/mol. Its IUPAC name is [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-bromobenzoate.
| Compound Name | [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 78237804 |
| Molecular Formula | C24H23BrO5 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-bromobenzoate |
| SMILES | Cc1ccc(C)c(OC2=COC3CC(OC(=O)c4ccc(Br)cc4)CCC3C2=O)c1 |
| InChI | InChI=1S/C24H23BrO5/c1-14-3-4-15(2)20(11-14)30-22-13-28-21-12-18(9-10-19(21)23(22)26)29-24(27)16-5-7-17(25)8-6-16/h3-8,11,13,18-19,21H,9-10,12H2,1-2H3 |
| InChIKey | OEOOYRAEHKRUOL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |