C23H25BrO3 — CID 101018264
[(1R,2S,3R)-3-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]cyclopentyl] 4-bromobenzoate (PubChem CID 101018264) has the molecular formula C23H25BrO3 and a molecular weight of 429.35 g/mol. Its IUPAC name is [(1R,2S,3R)-3-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]cyclopentyl] 4-bromobenzoate.
| Compound Name | [(1R,2S,3R)-3-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]cyclopentyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 101018264 |
| Molecular Formula | C23H25BrO3 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [(1R,2S,3R)-3-(phenylmethoxymethyl)-2-[(E)-prop-1-enyl]cyclopentyl] 4-bromobenzoate |
| SMILES | C/C=C/[C@H]1[C@H](COCc2ccccc2)CC[C@H]1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H25BrO3/c1-2-6-21-19(16-26-15-17-7-4-3-5-8-17)11-14-22(21)27-23(25)18-9-12-20(24)13-10-18/h2-10,12-13,19,21-22H,11,14-16H2,1H3/b6-2+/t19-,21-,22+/m0/s1 |
| InChIKey | RAPPEXCJHBZJBA-PQRDYABGSA-N |
| XLogP | 5.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|