C20H22O4 — CID 67078564
[(3R,6R)-6-(phenylmethoxymethyl)oxan-3-yl] benzoate (PubChem CID 67078564) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(3R,6R)-6-(phenylmethoxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(3R,6R)-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 67078564 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [(3R,6R)-6-(phenylmethoxymethyl)oxan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1CC[C@H](COCc2ccccc2)OC1)c1ccccc1 |
| InChI | InChI=1S/C20H22O4/c21-20(17-9-5-2-6-10-17)24-19-12-11-18(23-15-19)14-22-13-16-7-3-1-4-8-16/h1-10,18-19H,11-15H2/t18-,19-/m1/s1 |
| InChIKey | GYHMJPKWVYCAOP-RTBURBONSA-N |
| XLogP | 3.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |