C26H22O7 — CID 15870520
[(3S,5R,6R)-5,6-dibenzoyloxyoxan-3-yl] benzoate (PubChem CID 15870520) has the molecular formula C26H22O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is [(3S,5R,6R)-5,6-dibenzoyloxyoxan-3-yl] benzoate.
| Compound Name | [(3S,5R,6R)-5,6-dibenzoyloxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 15870520 |
| Molecular Formula | C26H22O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [(3S,5R,6R)-5,6-dibenzoyloxyoxan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1CO[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C26H22O7/c27-23(18-10-4-1-5-11-18)31-21-16-22(32-24(28)19-12-6-2-7-13-19)26(30-17-21)33-25(29)20-14-8-3-9-15-20/h1-15,21-22,26H,16-17H2/t21-,22+,26+/m0/s1 |
| InChIKey | KEZJMNCBKFAZNC-VVZHRXSXSA-N |
| XLogP | 4.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|