C18H23ClFNO7Si — CID 139095781
[(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-chloro-4-fluoro-5-oxooxolan-2-yl]methyl 4-nitrobenzoate (PubChem CID 139095781) has the molecular formula C18H23ClFNO7Si and a molecular weight of 447.92 g/mol. Its IUPAC name is [(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-chloro-4-fluoro-5-oxooxolan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-chloro-4-fluoro-5-oxooxolan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 139095781 |
| Molecular Formula | C18H23ClFNO7Si |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-chloro-4-fluoro-5-oxooxolan-2-yl]methyl 4-nitrobenzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COC(=O)c2ccc([N+](=O)[O-])cc2)OC(=O)[C@@]1(F)Cl |
| InChI | InChI=1S/C18H23ClFNO7Si/c1-17(2,3)29(4,5)28-14-13(27-16(23)18(14,19)20)10-26-15(22)11-6-8-12(9-7-11)21(24)25/h6-9,13-14H,10H2,1-5H3/t13-,14-,18-/m1/s1 |
| InChIKey | ZHCGATXJEZOAJP-HBUWYVDXSA-N |
| XLogP | 3.97 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|