C20H16Br2O7 — CID 145100191
[(2R,3R,4S)-3-(4-bromobenzoyl)oxy-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl 4-bromobenzoate (PubChem CID 145100191) has the molecular formula C20H16Br2O7 and a molecular weight of 528.15 g/mol. Its IUPAC name is [(2R,3R,4S)-3-(4-bromobenzoyl)oxy-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl 4-bromobenzoate.
| Compound Name | [(2R,3R,4S)-3-(4-bromobenzoyl)oxy-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 145100191 |
| Molecular Formula | C20H16Br2O7 |
| Molecular Weight | 528.15 g/mol |
| Exact Mass | 525.93 |
| IUPAC Name | [(2R,3R,4S)-3-(4-bromobenzoyl)oxy-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl 4-bromobenzoate |
| SMILES | C[C@@]1(O)C(=O)O[C@H](COC(=O)c2ccc(Br)cc2)[C@H]1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H16Br2O7/c1-20(26)16(29-18(24)12-4-8-14(22)9-5-12)15(28-19(20)25)10-27-17(23)11-2-6-13(21)7-3-11/h2-9,15-16,26H,10H2,1H3/t15-,16-,20+/m1/s1 |
| InChIKey | HDSHSLACTUFTTH-QINHECLXSA-N |
| XLogP | 3.27 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|