C21H23NO4 — CID 10970249
3,3-dimethyl-1-[(1S,3R)-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromen-1-yl]butan-2-one (PubChem CID 10970249) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(1S,3R)-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromen-1-yl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[(1S,3R)-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromen-1-yl]butan-2-one |
|---|---|
| PubChem CID | 10970249 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3,3-dimethyl-1-[(1S,3R)-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromen-1-yl]butan-2-one |
| SMILES | CC(C)(C)C(=O)C[C@@H]1O[C@@H](c2ccc([N+](=O)[O-])cc2)Cc2ccccc21 |
| InChI | InChI=1S/C21H23NO4/c1-21(2,3)20(23)13-19-17-7-5-4-6-15(17)12-18(26-19)14-8-10-16(11-9-14)22(24)25/h4-11,18-19H,12-13H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | HNSHOJYKWNOFEO-MOPGFXCFSA-N |
| XLogP | 4.96 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|