C15H13N3O4 — CID 102477658
(2S,4S)-2-(4-nitrophenyl)-3-nitroso-4-phenyl-1,3-oxazolidine (PubChem CID 102477658) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is (2S,4S)-2-(4-nitrophenyl)-3-nitroso-4-phenyl-1,3-oxazolidine.
| Compound Name | (2S,4S)-2-(4-nitrophenyl)-3-nitroso-4-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 102477658 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2S,4S)-2-(4-nitrophenyl)-3-nitroso-4-phenyl-1,3-oxazolidine |
| SMILES | O=NN1[C@@H](c2ccccc2)CO[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N3O4/c19-16-17-14(11-4-2-1-3-5-11)10-22-15(17)12-6-8-13(9-7-12)18(20)21/h1-9,14-15H,10H2/t14-,15+/m1/s1 |
| InChIKey | XCPSEKSZIZECMA-CABCVRRESA-N |
| XLogP | 3.35 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|