About (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine
(2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine (PubChem CID 102477659) has the molecular formula C16H16N2O3
and a molecular weight of 284.32 g/mol. Its IUPAC name is (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine |
| PubChem CID | 102477659 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine |
| SMILES | COc1ccc([C@@H]2OC[C@H](c3ccccc3)N2N=O)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-20-14-9-7-13(8-10-14)16-18(17-19)15(11-21-16)12-5-3-2-4-6-12/h2-10,15-16H,11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | XVYYHYWIQRGIDY-CVEARBPZSA-N |
| XLogP | 3.45 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine?
The IUPAC name of (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine (CID 102477659) is (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine.
What is the SMILES notation for (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine?
The canonical SMILES for (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine is COc1ccc([C@@H]2OC[C@H](c3ccccc3)N2N=O)cc1.
What is the InChIKey of (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine?
The InChIKey is XVYYHYWIQRGIDY-CVEARBPZSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-20-14-9-7-13(8-10-14)16-18(17-19)15(11-21-16)12-5-3-2-4-6-12/h2-10,15-16H,11H2,1H3/t15-,16+/m1/s1.
What are the key properties of (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine?
(2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine has a molecular weight of 284.32 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2-(4-methoxyphenyl)-3-nitroso-4-phenyl-1,3-oxazolidine is sourced from PubChem (CID 102477659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).