C10H12N2O3 — CID 101429995
2-(4-methoxyphenyl)-3-nitroso-1,3-oxazolidine (PubChem CID 101429995) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-nitroso-1,3-oxazolidine.
| Compound Name | 2-(4-methoxyphenyl)-3-nitroso-1,3-oxazolidine |
|---|---|
| PubChem CID | 101429995 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-nitroso-1,3-oxazolidine |
| SMILES | COc1ccc(C2OCCN2N=O)cc1 |
| InChI | InChI=1S/C10H12N2O3/c1-14-9-4-2-8(3-5-9)10-12(11-13)6-7-15-10/h2-5,10H,6-7H2,1H3 |
| InChIKey | LJUFESKXBLJWFO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|