C19H23NO2 — CID 155814589
4-benzyl-7-(4-methoxyphenyl)-1,4-oxazepane (PubChem CID 155814589) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-benzyl-7-(4-methoxyphenyl)-1,4-oxazepane.
| Compound Name | 4-benzyl-7-(4-methoxyphenyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 155814589 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-benzyl-7-(4-methoxyphenyl)-1,4-oxazepane |
| SMILES | COc1ccc(C2CCN(Cc3ccccc3)CCO2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-21-18-9-7-17(8-10-18)19-11-12-20(13-14-22-19)15-16-5-3-2-4-6-16/h2-10,19H,11-15H2,1H3 |
| InChIKey | SNCPVWFEKYOFEI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |