C24H31N3O — CID 157015180
6-(1-benzylpiperidin-4-yl)-2-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptane (PubChem CID 157015180) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 6-(1-benzylpiperidin-4-yl)-2-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 6-(1-benzylpiperidin-4-yl)-2-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 157015180 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 6-(1-benzylpiperidin-4-yl)-2-(4-methoxyphenyl)-2,6-diazaspiro[3.3]heptane |
| SMILES | COc1ccc(N2CC3(C2)CN(C2CCN(Cc4ccccc4)CC2)C3)cc1 |
| InChI | InChI=1S/C24H31N3O/c1-28-23-9-7-21(8-10-23)26-16-24(17-26)18-27(19-24)22-11-13-25(14-12-22)15-20-5-3-2-4-6-20/h2-10,22H,11-19H2,1H3 |
| InChIKey | OQRBKDRPNGFLTI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|